C20H23N3O — CID 90554297
1-[3-[4-(dimethylamino)phenyl]prop-2-ynyl]-3-(2-phenylethyl)urea (PubChem CID 90554297) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 1-[3-[4-(dimethylamino)phenyl]prop-2-ynyl]-3-(2-phenylethyl)urea.
| Compound Name | 1-[3-[4-(dimethylamino)phenyl]prop-2-ynyl]-3-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 90554297 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 1-[3-[4-(dimethylamino)phenyl]prop-2-ynyl]-3-(2-phenylethyl)urea |
| SMILES | CN(C)c1ccc(C#CCNC(=O)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H23N3O/c1-23(2)19-12-10-18(11-13-19)9-6-15-21-20(24)22-16-14-17-7-4-3-5-8-17/h3-5,7-8,10-13H,14-16H2,1-2H3,(H2,21,22,24) |
| InChIKey | HJVOOOUVUNDOSR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|