About 3-bromo-2-methoxythiophene;ethynylbenzene;4-methoxybenzenesulfonyl chloride
3-bromo-2-methoxythiophene;ethynylbenzene;4-methoxybenzenesulfonyl chloride (PubChem CID 159415036) has the molecular formula C20H18BrClO4S2
and a molecular weight of 501.85 g/mol. Its IUPAC name is 3-bromo-2-methoxythiophene;ethynylbenzene;4-methoxybenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 3-bromo-2-methoxythiophene;ethynylbenzene;4-methoxybenzenesulfonyl chloride |
| PubChem CID | 159415036 |
| Molecular Formula | C20H18BrClO4S2 |
| Molecular Weight | 501.85 g/mol |
| Exact Mass | 499.95 |
| IUPAC Name | 3-bromo-2-methoxythiophene;ethynylbenzene;4-methoxybenzenesulfonyl chloride |
| SMILES | C#Cc1ccccc1.COc1ccc(S(=O)(=O)Cl)cc1.COc1sccc1Br |
| InChI | InChI=1S/C8H6.C7H7ClO3S.C5H5BrOS/c1-2-8-6-4-3-5-7-8;1-11-6-2-4-7(5-3-6)12(8,9)10;1-7-5-4(6)2-3-8-5/h1,3-7H;2-5H,1H3;2-3H,1H3 |
| InChIKey | LPBBCEAJMXIOKR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.85 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-methoxythiophene;ethynylbenzene;4-methoxybenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-methoxythiophene;ethynylbenzene;4-methoxybenzenesulfonyl chloride?
The IUPAC name of 3-bromo-2-methoxythiophene;ethynylbenzene;4-methoxybenzenesulfonyl chloride (CID 159415036) is 3-bromo-2-methoxythiophene;ethynylbenzene;4-methoxybenzenesulfonyl chloride.
What is the SMILES notation for 3-bromo-2-methoxythiophene;ethynylbenzene;4-methoxybenzenesulfonyl chloride?
The canonical SMILES for 3-bromo-2-methoxythiophene;ethynylbenzene;4-methoxybenzenesulfonyl chloride is C#Cc1ccccc1.COc1ccc(S(=O)(=O)Cl)cc1.COc1sccc1Br.
What is the InChIKey of 3-bromo-2-methoxythiophene;ethynylbenzene;4-methoxybenzenesulfonyl chloride?
The InChIKey is LPBBCEAJMXIOKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6.C7H7ClO3S.C5H5BrOS/c1-2-8-6-4-3-5-7-8;1-11-6-2-4-7(5-3-6)12(8,9)10;1-7-5-4(6)2-3-8-5/h1,3-7H;2-5H,1H3;2-3H,1H3.
What are the key properties of 3-bromo-2-methoxythiophene;ethynylbenzene;4-methoxybenzenesulfonyl chloride?
3-bromo-2-methoxythiophene;ethynylbenzene;4-methoxybenzenesulfonyl chloride has a molecular weight of 501.85 g/mol, XLogP of 5.81, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-methoxythiophene;ethynylbenzene;4-methoxybenzenesulfonyl chloride is sourced from PubChem (CID 159415036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).