C26H21Cl2NO3S — CID 159196851
3-chloro-4-isocyano-1,2-dihydronaphthalene;ethynylbenzene;4-methoxybenzenesulfonyl chloride (PubChem CID 159196851) has the molecular formula C26H21Cl2NO3S and a molecular weight of 498.43 g/mol. Its IUPAC name is 3-chloro-4-isocyano-1,2-dihydronaphthalene;ethynylbenzene;4-methoxybenzenesulfonyl chloride.
| Compound Name | 3-chloro-4-isocyano-1,2-dihydronaphthalene;ethynylbenzene;4-methoxybenzenesulfonyl chloride |
|---|---|
| PubChem CID | 159196851 |
| Molecular Formula | C26H21Cl2NO3S |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | 3-chloro-4-isocyano-1,2-dihydronaphthalene;ethynylbenzene;4-methoxybenzenesulfonyl chloride |
| SMILES | C#Cc1ccccc1.COc1ccc(S(=O)(=O)Cl)cc1.[C-]#[N+]C1=C(Cl)CCc2ccccc21 |
| InChI | InChI=1S/C11H8ClN.C8H6.C7H7ClO3S/c1-13-11-9-5-3-2-4-8(9)6-7-10(11)12;1-2-8-6-4-3-5-7-8;1-11-6-2-4-7(5-3-6)12(8,9)10/h2-5H,6-7H2;1,3-7H;2-5H,1H3 |
| InChIKey | KOTPBXUVDWVUDM-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|