About ethynylbenzene;2-iodo-5-methoxyaniline;5-methoxy-2-(2-phenylethynyl)aniline
ethynylbenzene;2-iodo-5-methoxyaniline;5-methoxy-2-(2-phenylethynyl)aniline (PubChem CID 158836117) has the molecular formula C30H27IN2O2
and a molecular weight of 574.46 g/mol. Its IUPAC name is ethynylbenzene;2-iodo-5-methoxyaniline;5-methoxy-2-(2-phenylethynyl)aniline.
Molecular Properties
| Compound Name | ethynylbenzene;2-iodo-5-methoxyaniline;5-methoxy-2-(2-phenylethynyl)aniline |
| PubChem CID | 158836117 |
| Molecular Formula | C30H27IN2O2 |
| Molecular Weight | 574.46 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | ethynylbenzene;2-iodo-5-methoxyaniline;5-methoxy-2-(2-phenylethynyl)aniline |
| SMILES | C#Cc1ccccc1.COc1ccc(C#Cc2ccccc2)c(N)c1.COc1ccc(I)c(N)c1 |
| InChI | InChI=1S/C15H13NO.C8H6.C7H8INO/c1-17-14-10-9-13(15(16)11-14)8-7-12-5-3-2-4-6-12;1-2-8-6-4-3-5-7-8;1-10-5-2-3-6(8)7(9)4-5/h2-6,9-11H,16H2,1H3;1,3-7H;2-4H,9H2,1H3 |
| InChIKey | IXQUNTNTVNHWRP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 574.46 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethynylbenzene;2-iodo-5-methoxyaniline;5-methoxy-2-(2-phenylethynyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethynylbenzene;2-iodo-5-methoxyaniline;5-methoxy-2-(2-phenylethynyl)aniline?
The IUPAC name of ethynylbenzene;2-iodo-5-methoxyaniline;5-methoxy-2-(2-phenylethynyl)aniline (CID 158836117) is ethynylbenzene;2-iodo-5-methoxyaniline;5-methoxy-2-(2-phenylethynyl)aniline.
What is the SMILES notation for ethynylbenzene;2-iodo-5-methoxyaniline;5-methoxy-2-(2-phenylethynyl)aniline?
The canonical SMILES for ethynylbenzene;2-iodo-5-methoxyaniline;5-methoxy-2-(2-phenylethynyl)aniline is C#Cc1ccccc1.COc1ccc(C#Cc2ccccc2)c(N)c1.COc1ccc(I)c(N)c1.
What is the InChIKey of ethynylbenzene;2-iodo-5-methoxyaniline;5-methoxy-2-(2-phenylethynyl)aniline?
The InChIKey is IXQUNTNTVNHWRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO.C8H6.C7H8INO/c1-17-14-10-9-13(15(16)11-14)8-7-12-5-3-2-4-6-12;1-2-8-6-4-3-5-7-8;1-10-5-2-3-6(8)7(9)4-5/h2-6,9-11H,16H2,1H3;1,3-7H;2-4H,9H2,1H3.
What are the key properties of ethynylbenzene;2-iodo-5-methoxyaniline;5-methoxy-2-(2-phenylethynyl)aniline?
ethynylbenzene;2-iodo-5-methoxyaniline;5-methoxy-2-(2-phenylethynyl)aniline has a molecular weight of 574.46 g/mol, XLogP of 6.23, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethynylbenzene;2-iodo-5-methoxyaniline;5-methoxy-2-(2-phenylethynyl)aniline is sourced from PubChem (CID 158836117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).