C16H15NO — CID 18738935
2-[2-(4-methoxyphenyl)ethynyl]-5-methylaniline (PubChem CID 18738935) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)ethynyl]-5-methylaniline.
| Compound Name | 2-[2-(4-methoxyphenyl)ethynyl]-5-methylaniline |
|---|---|
| PubChem CID | 18738935 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)ethynyl]-5-methylaniline |
| SMILES | COc1ccc(C#Cc2ccc(C)cc2N)cc1 |
| InChI | InChI=1S/C16H15NO/c1-12-3-7-14(16(17)11-12)8-4-13-5-9-15(18-2)10-6-13/h3,5-7,9-11H,17H2,1-2H3 |
| InChIKey | OTIIMODMCZODPQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|