About diphenylphosphane;1-methoxy-4-phenylbenzene;hydrochloride
diphenylphosphane;1-methoxy-4-phenylbenzene;hydrochloride (PubChem CID 175558658) has the molecular formula C25H24ClOP
and a molecular weight of 406.89 g/mol. Its IUPAC name is diphenylphosphane;1-methoxy-4-phenylbenzene;hydrochloride.
Molecular Properties
| Compound Name | diphenylphosphane;1-methoxy-4-phenylbenzene;hydrochloride |
| PubChem CID | 175558658 |
| Molecular Formula | C25H24ClOP |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | diphenylphosphane;1-methoxy-4-phenylbenzene;hydrochloride |
| SMILES | COc1ccc(-c2ccccc2)cc1.Cl.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12O.C12H11P.ClH/c1-14-13-9-7-12(8-10-13)11-5-3-2-4-6-11;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h2-10H,1H3;1-10,13H;1H |
| InChIKey | VVIKYHDXZBOLBU-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphane;1-methoxy-4-phenylbenzene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphane;1-methoxy-4-phenylbenzene;hydrochloride?
The IUPAC name of diphenylphosphane;1-methoxy-4-phenylbenzene;hydrochloride (CID 175558658) is diphenylphosphane;1-methoxy-4-phenylbenzene;hydrochloride.
What is the SMILES notation for diphenylphosphane;1-methoxy-4-phenylbenzene;hydrochloride?
The canonical SMILES for diphenylphosphane;1-methoxy-4-phenylbenzene;hydrochloride is COc1ccc(-c2ccccc2)cc1.Cl.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of diphenylphosphane;1-methoxy-4-phenylbenzene;hydrochloride?
The InChIKey is VVIKYHDXZBOLBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O.C12H11P.ClH/c1-14-13-9-7-12(8-10-13)11-5-3-2-4-6-11;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h2-10H,1H3;1-10,13H;1H.
What are the key properties of diphenylphosphane;1-methoxy-4-phenylbenzene;hydrochloride?
diphenylphosphane;1-methoxy-4-phenylbenzene;hydrochloride has a molecular weight of 406.89 g/mol, XLogP of 6.10, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphane;1-methoxy-4-phenylbenzene;hydrochloride is sourced from PubChem (CID 175558658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).