C20H22O6 — CID 68940500
(3S,4S,5S,6S)-1,8-diphenylocta-1,7-diene-2,3,4,5,6,7-hexol (PubChem CID 68940500) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is (3S,4S,5S,6S)-1,8-diphenylocta-1,7-diene-2,3,4,5,6,7-hexol.
| Compound Name | (3S,4S,5S,6S)-1,8-diphenylocta-1,7-diene-2,3,4,5,6,7-hexol |
|---|---|
| PubChem CID | 68940500 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (3S,4S,5S,6S)-1,8-diphenylocta-1,7-diene-2,3,4,5,6,7-hexol |
| SMILES | OC(=Cc1ccccc1)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)=Cc1ccccc1 |
| InChI | InChI=1S/C20H22O6/c21-15(11-13-7-3-1-4-8-13)17(23)19(25)20(26)18(24)16(22)12-14-9-5-2-6-10-14/h1-12,17-26H/t17-,18-,19-,20-/m1/s1 |
| InChIKey | NWXADGGHXYSLSP-UAFMIMERSA-N |
| XLogP | 1.63 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|