C13H17BrO6 — CID 175044347
7-(3-bromophenyl)hept-6-ene-1,2,3,4,5,6-hexol (PubChem CID 175044347) has the molecular formula C13H17BrO6 and a molecular weight of 349.18 g/mol. Its IUPAC name is 7-(3-bromophenyl)hept-6-ene-1,2,3,4,5,6-hexol.
| Compound Name | 7-(3-bromophenyl)hept-6-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 175044347 |
| Molecular Formula | C13H17BrO6 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 7-(3-bromophenyl)hept-6-ene-1,2,3,4,5,6-hexol |
| SMILES | OCC(O)C(O)C(O)C(O)C(O)=Cc1cccc(Br)c1 |
| InChI | InChI=1S/C13H17BrO6/c14-8-3-1-2-7(4-8)5-9(16)11(18)13(20)12(19)10(17)6-15/h1-5,10-13,15-20H,6H2 |
| InChIKey | FSCNXHDHAWGKAW-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|