C20H20N2O10 — CID 142081430
(3S,4S,5R,6S)-3,4-dinitro-1,8-diphenylocta-1,7-diene-2,3,4,5,6,7-hexol (PubChem CID 142081430) has the molecular formula C20H20N2O10 and a molecular weight of 448.38 g/mol. Its IUPAC name is (3S,4S,5R,6S)-3,4-dinitro-1,8-diphenylocta-1,7-diene-2,3,4,5,6,7-hexol.
| Compound Name | (3S,4S,5R,6S)-3,4-dinitro-1,8-diphenylocta-1,7-diene-2,3,4,5,6,7-hexol |
|---|---|
| PubChem CID | 142081430 |
| Molecular Formula | C20H20N2O10 |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | (3S,4S,5R,6S)-3,4-dinitro-1,8-diphenylocta-1,7-diene-2,3,4,5,6,7-hexol |
| SMILES | O=[N+]([O-])[C@](O)(C(O)=Cc1ccccc1)[C@@](O)([C@H](O)[C@H](O)C(O)=Cc1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N2O10/c23-15(11-13-7-3-1-4-8-13)17(25)18(26)20(28,22(31)32)19(27,21(29)30)16(24)12-14-9-5-2-6-10-14/h1-12,17-18,23-28H/t17-,18-,19+,20+/m1/s1 |
| InChIKey | WZSFMJDUKJCGGA-ZRNYENFQSA-N |
| XLogP | 0.84 |
| TPSA | 207.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|