About 2-phenylpent-4-ynal
2-phenylpent-4-ynal (PubChem CID 14713497) has the molecular formula C11H10O
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-phenylpent-4-ynal.
Molecular Properties
| Compound Name | 2-phenylpent-4-ynal |
| PubChem CID | 14713497 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 2-phenylpent-4-ynal |
| SMILES | C#CCC(C=O)c1ccccc1 |
| InChI | InChI=1S/C11H10O/c1-2-6-11(9-12)10-7-4-3-5-8-10/h1,3-5,7-9,11H,6H2 |
| InChIKey | FMCXVOMEDNWTAG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylpent-4-ynal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpent-4-ynal?
The IUPAC name of 2-phenylpent-4-ynal (CID 14713497) is 2-phenylpent-4-ynal.
What is the SMILES notation for 2-phenylpent-4-ynal?
The canonical SMILES for 2-phenylpent-4-ynal is C#CCC(C=O)c1ccccc1.
What is the InChIKey of 2-phenylpent-4-ynal?
The InChIKey is FMCXVOMEDNWTAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O/c1-2-6-11(9-12)10-7-4-3-5-8-10/h1,3-5,7-9,11H,6H2.
What are the key properties of 2-phenylpent-4-ynal?
2-phenylpent-4-ynal has a molecular weight of 158.20 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpent-4-ynal is sourced from PubChem (CID 14713497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).