About 1-phenylbut-3-ynyl carbonochloridate
1-phenylbut-3-ynyl carbonochloridate (PubChem CID 11148475) has the molecular formula C11H9ClO2
and a molecular weight of 208.64 g/mol. Its IUPAC name is 1-phenylbut-3-ynyl carbonochloridate.
Molecular Properties
| Compound Name | 1-phenylbut-3-ynyl carbonochloridate |
| PubChem CID | 11148475 |
| Molecular Formula | C11H9ClO2 |
| Molecular Weight | 208.64 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 1-phenylbut-3-ynyl carbonochloridate |
| SMILES | C#CCC(OC(=O)Cl)c1ccccc1 |
| InChI | InChI=1S/C11H9ClO2/c1-2-6-10(14-11(12)13)9-7-4-3-5-8-9/h1,3-5,7-8,10H,6H2 |
| InChIKey | PATQBEGGFWZFMF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.64 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylbut-3-ynyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylbut-3-ynyl carbonochloridate?
The IUPAC name of 1-phenylbut-3-ynyl carbonochloridate (CID 11148475) is 1-phenylbut-3-ynyl carbonochloridate.
What is the SMILES notation for 1-phenylbut-3-ynyl carbonochloridate?
The canonical SMILES for 1-phenylbut-3-ynyl carbonochloridate is C#CCC(OC(=O)Cl)c1ccccc1.
What is the InChIKey of 1-phenylbut-3-ynyl carbonochloridate?
The InChIKey is PATQBEGGFWZFMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClO2/c1-2-6-10(14-11(12)13)9-7-4-3-5-8-9/h1,3-5,7-8,10H,6H2.
What are the key properties of 1-phenylbut-3-ynyl carbonochloridate?
1-phenylbut-3-ynyl carbonochloridate has a molecular weight of 208.64 g/mol, XLogP of 3.13, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylbut-3-ynyl carbonochloridate is sourced from PubChem (CID 11148475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).