C24H30O5Si — CID 11015445
[(1S)-1-(5-triethylsilylfuran-3-yl)but-3-ynyl] (2S)-2-acetyloxy-2-phenylacetate (PubChem CID 11015445) has the molecular formula C24H30O5Si and a molecular weight of 426.59 g/mol. Its IUPAC name is [(1S)-1-(5-triethylsilylfuran-3-yl)but-3-ynyl] (2S)-2-acetyloxy-2-phenylacetate.
| Compound Name | [(1S)-1-(5-triethylsilylfuran-3-yl)but-3-ynyl] (2S)-2-acetyloxy-2-phenylacetate |
|---|---|
| PubChem CID | 11015445 |
| Molecular Formula | C24H30O5Si |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | [(1S)-1-(5-triethylsilylfuran-3-yl)but-3-ynyl] (2S)-2-acetyloxy-2-phenylacetate |
| SMILES | C#CC[C@H](OC(=O)[C@@H](OC(C)=O)c1ccccc1)c1coc([Si](CC)(CC)CC)c1 |
| InChI | InChI=1S/C24H30O5Si/c1-6-13-21(20-16-22(27-17-20)30(7-2,8-3)9-4)29-24(26)23(28-18(5)25)19-14-11-10-12-15-19/h1,10-12,14-17,21,23H,7-9,13H2,2-5H3/t21-,23-/m0/s1 |
| InChIKey | NHYZFIOTJXVWFS-GMAHTHKFSA-N |
| XLogP | 4.91 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|