About 2-phenylbutanal;[(E)-prop-1-enyl]benzene
2-phenylbutanal;[(E)-prop-1-enyl]benzene (PubChem CID 23461088) has the molecular formula C19H22O
and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-phenylbutanal;[(E)-prop-1-enyl]benzene.
Molecular Properties
| Compound Name | 2-phenylbutanal;[(E)-prop-1-enyl]benzene |
| PubChem CID | 23461088 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-phenylbutanal;[(E)-prop-1-enyl]benzene |
| SMILES | C/C=C/c1ccccc1.CCC(C=O)c1ccccc1 |
| InChI | InChI=1S/C10H12O.C9H10/c1-2-9(8-11)10-6-4-3-5-7-10;1-2-6-9-7-4-3-5-8-9/h3-9H,2H2,1H3;2-8H,1H3/b;6-2+ |
| InChIKey | PNCFXWQRXKTECZ-RPPWHJSFSA-N |
| XLogP | 5.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylbutanal;[(E)-prop-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylbutanal;[(E)-prop-1-enyl]benzene?
The IUPAC name of 2-phenylbutanal;[(E)-prop-1-enyl]benzene (CID 23461088) is 2-phenylbutanal;[(E)-prop-1-enyl]benzene.
What is the SMILES notation for 2-phenylbutanal;[(E)-prop-1-enyl]benzene?
The canonical SMILES for 2-phenylbutanal;[(E)-prop-1-enyl]benzene is C/C=C/c1ccccc1.CCC(C=O)c1ccccc1.
What is the InChIKey of 2-phenylbutanal;[(E)-prop-1-enyl]benzene?
The InChIKey is PNCFXWQRXKTECZ-RPPWHJSFSA-N. The full InChI is InChI=1S/C10H12O.C9H10/c1-2-9(8-11)10-6-4-3-5-7-10;1-2-6-9-7-4-3-5-8-9/h3-9H,2H2,1H3;2-8H,1H3/b;6-2+.
What are the key properties of 2-phenylbutanal;[(E)-prop-1-enyl]benzene?
2-phenylbutanal;[(E)-prop-1-enyl]benzene has a molecular weight of 266.38 g/mol, XLogP of 5.10, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylbutanal;[(E)-prop-1-enyl]benzene is sourced from PubChem (CID 23461088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).