C17H12BrCl3O2 — CID 10993786
[(E)-2-bromo-1,3-diphenylprop-2-enyl] 2,2,2-trichloroacetate (PubChem CID 10993786) has the molecular formula C17H12BrCl3O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is [(E)-2-bromo-1,3-diphenylprop-2-enyl] 2,2,2-trichloroacetate.
| Compound Name | [(E)-2-bromo-1,3-diphenylprop-2-enyl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 10993786 |
| Molecular Formula | C17H12BrCl3O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 431.91 |
| IUPAC Name | [(E)-2-bromo-1,3-diphenylprop-2-enyl] 2,2,2-trichloroacetate |
| SMILES | O=C(OC(/C(Br)=C\c1ccccc1)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H12BrCl3O2/c18-14(11-12-7-3-1-4-8-12)15(13-9-5-2-6-10-13)23-16(22)17(19,20)21/h1-11,15H/b14-11+ |
| InChIKey | HCDJOPCIERJJMO-SDNWHVSQSA-N |
| XLogP | 6.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|