C11H15F2NO — CID 171161723
(1S,2R)-1-amino-1-(2,5-difluorophenyl)pentan-2-ol (PubChem CID 171161723) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(2,5-difluorophenyl)pentan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(2,5-difluorophenyl)pentan-2-ol |
|---|---|
| PubChem CID | 171161723 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | (1S,2R)-1-amino-1-(2,5-difluorophenyl)pentan-2-ol |
| SMILES | CCC[C@@H](O)[C@@H](N)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H15F2NO/c1-2-3-10(15)11(14)8-6-7(12)4-5-9(8)13/h4-6,10-11,15H,2-3,14H2,1H3/t10-,11+/m1/s1 |
| InChIKey | VDDFITKWOGEVLS-MNOVXSKESA-N |
| XLogP | 2.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |