C17H19Cl2NO5 — CID 7851805
4-O-[(2S)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 1-O-ethyl (E)-but-2-enedioate (PubChem CID 7851805) has the molecular formula C17H19Cl2NO5 and a molecular weight of 388.25 g/mol. Its IUPAC name is 4-O-[(2S)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 1-O-ethyl (E)-but-2-enedioate.
| Compound Name | 4-O-[(2S)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 1-O-ethyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 7851805 |
| Molecular Formula | C17H19Cl2NO5 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 4-O-[(2S)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 1-O-ethyl (E)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=O)O[C@@H](C)C(=O)N[C@H](C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H19Cl2NO5/c1-4-24-15(21)7-8-16(22)25-11(3)17(23)20-10(2)13-6-5-12(18)9-14(13)19/h5-11H,4H2,1-3H3,(H,20,23)/b8-7+/t10-,11+/m1/s1 |
| InChIKey | SZEOOGOITPFBTN-SFEFJYQLSA-N |
| XLogP | 3.22 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|