C18H19N3O6 — CID 9067562
[2-(2-benzoylhydrazinyl)-2-oxoethyl] 4-(furan-2-ylmethylamino)-4-oxobutanoate (PubChem CID 9067562) has the molecular formula C18H19N3O6 and a molecular weight of 373.37 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] 4-(furan-2-ylmethylamino)-4-oxobutanoate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 4-(furan-2-ylmethylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 9067562 |
| Molecular Formula | C18H19N3O6 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 4-(furan-2-ylmethylamino)-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCC(=O)NNC(=O)c1ccccc1)NCc1ccco1 |
| InChI | InChI=1S/C18H19N3O6/c22-15(19-11-14-7-4-10-26-14)8-9-17(24)27-12-16(23)20-21-18(25)13-5-2-1-3-6-13/h1-7,10H,8-9,11-12H2,(H,19,22)(H,20,23)(H,21,25) |
| InChIKey | KVAFZISQJYGHFN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|