About 2-bromoethyl 3-(furan-2-yl)propanoate
2-bromoethyl 3-(furan-2-yl)propanoate (PubChem CID 174386659) has the molecular formula C9H11BrO3
and a molecular weight of 247.09 g/mol. Its IUPAC name is 2-bromoethyl 3-(furan-2-yl)propanoate.
Molecular Properties
| Compound Name | 2-bromoethyl 3-(furan-2-yl)propanoate |
| PubChem CID | 174386659 |
| Molecular Formula | C9H11BrO3 |
| Molecular Weight | 247.09 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | 2-bromoethyl 3-(furan-2-yl)propanoate |
| SMILES | O=C(CCc1ccco1)OCCBr |
| InChI | InChI=1S/C9H11BrO3/c10-5-7-13-9(11)4-3-8-2-1-6-12-8/h1-2,6H,3-5,7H2 |
| InChIKey | QZBXCPZTWIVZKF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.09 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoethyl 3-(furan-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoethyl 3-(furan-2-yl)propanoate?
The IUPAC name of 2-bromoethyl 3-(furan-2-yl)propanoate (CID 174386659) is 2-bromoethyl 3-(furan-2-yl)propanoate.
What is the SMILES notation for 2-bromoethyl 3-(furan-2-yl)propanoate?
The canonical SMILES for 2-bromoethyl 3-(furan-2-yl)propanoate is O=C(CCc1ccco1)OCCBr.
What is the InChIKey of 2-bromoethyl 3-(furan-2-yl)propanoate?
The InChIKey is QZBXCPZTWIVZKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrO3/c10-5-7-13-9(11)4-3-8-2-1-6-12-8/h1-2,6H,3-5,7H2.
What are the key properties of 2-bromoethyl 3-(furan-2-yl)propanoate?
2-bromoethyl 3-(furan-2-yl)propanoate has a molecular weight of 247.09 g/mol, XLogP of 2.15, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoethyl 3-(furan-2-yl)propanoate is sourced from PubChem (CID 174386659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).