About 2-bromoethyl 3-aminopropanoate
2-bromoethyl 3-aminopropanoate (PubChem CID 15703163) has the molecular formula C5H10BrNO2
and a molecular weight of 196.04 g/mol. Its IUPAC name is 2-bromoethyl 3-aminopropanoate.
Molecular Properties
| Compound Name | 2-bromoethyl 3-aminopropanoate |
| PubChem CID | 15703163 |
| Molecular Formula | C5H10BrNO2 |
| Molecular Weight | 196.04 g/mol |
| Exact Mass | 194.99 |
| IUPAC Name | 2-bromoethyl 3-aminopropanoate |
| SMILES | NCCC(=O)OCCBr |
| InChI | InChI=1S/C5H10BrNO2/c6-2-4-9-5(8)1-3-7/h1-4,7H2 |
| InChIKey | PUXYDVCAUOPOOZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.04 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoethyl 3-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoethyl 3-aminopropanoate?
The IUPAC name of 2-bromoethyl 3-aminopropanoate (CID 15703163) is 2-bromoethyl 3-aminopropanoate.
What is the SMILES notation for 2-bromoethyl 3-aminopropanoate?
The canonical SMILES for 2-bromoethyl 3-aminopropanoate is NCCC(=O)OCCBr.
What is the InChIKey of 2-bromoethyl 3-aminopropanoate?
The InChIKey is PUXYDVCAUOPOOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10BrNO2/c6-2-4-9-5(8)1-3-7/h1-4,7H2.
What are the key properties of 2-bromoethyl 3-aminopropanoate?
2-bromoethyl 3-aminopropanoate has a molecular weight of 196.04 g/mol, XLogP of 0.27, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoethyl 3-aminopropanoate is sourced from PubChem (CID 15703163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).