C17H16F3NO2 — CID 86915357
N-benzhydryl-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 86915357) has the molecular formula C17H16F3NO2 and a molecular weight of 323.31 g/mol. Its IUPAC name is N-benzhydryl-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-benzhydryl-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 86915357 |
| Molecular Formula | C17H16F3NO2 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-benzhydryl-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | O=C(COCC(F)(F)F)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H16F3NO2/c18-17(19,20)12-23-11-15(22)21-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,16H,11-12H2,(H,21,22) |
| InChIKey | RTCXMHWYAWSQBJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |