C11H12N2O6S — CID 2528542
[2-(carbamoylamino)-2-oxoethyl] 3-methylsulfonylbenzoate (PubChem CID 2528542) has the molecular formula C11H12N2O6S and a molecular weight of 300.29 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 3-methylsulfonylbenzoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 3-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 2528542 |
| Molecular Formula | C11H12N2O6S |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 3-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1cccc(C(=O)OCC(=O)NC(N)=O)c1 |
| InChI | InChI=1S/C11H12N2O6S/c1-20(17,18)8-4-2-3-7(5-8)10(15)19-6-9(14)13-11(12)16/h2-5H,6H2,1H3,(H3,12,13,14,16) |
| InChIKey | YSMBNUKJZZUOSB-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |