C27H27NO8S — CID 2465865
[(1R)-2-oxo-1,2-diphenylethyl] 2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 2465865) has the molecular formula C27H27NO8S and a molecular weight of 525.58 g/mol. Its IUPAC name is [(1R)-2-oxo-1,2-diphenylethyl] 2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [(1R)-2-oxo-1,2-diphenylethyl] 2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2465865 |
| Molecular Formula | C27H27NO8S |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | [(1R)-2-oxo-1,2-diphenylethyl] 2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | COc1cc(S(=O)(=O)N2CCOCC2)cc(C(=O)O[C@@H](C(=O)c2ccccc2)c2ccccc2)c1OC |
| InChI | InChI=1S/C27H27NO8S/c1-33-23-18-21(37(31,32)28-13-15-35-16-14-28)17-22(26(23)34-2)27(30)36-25(20-11-7-4-8-12-20)24(29)19-9-5-3-6-10-19/h3-12,17-18,25H,13-16H2,1-2H3/t25-/m1/s1 |
| InChIKey | OIYZZMUDKODWEN-RUZDIDTESA-N |
| XLogP | 3.51 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |