C20H33N3O6S — CID 55676114
N-[2-(diethylamino)propyl]-2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 55676114) has the molecular formula C20H33N3O6S and a molecular weight of 443.57 g/mol. Its IUPAC name is N-[2-(diethylamino)propyl]-2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[2-(diethylamino)propyl]-2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55676114 |
| Molecular Formula | C20H33N3O6S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | N-[2-(diethylamino)propyl]-2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCN(CC)C(C)CNC(=O)c1cc(S(=O)(=O)N2CCOCC2)cc(OC)c1OC |
| InChI | InChI=1S/C20H33N3O6S/c1-6-22(7-2)15(3)14-21-20(24)17-12-16(13-18(27-4)19(17)28-5)30(25,26)23-8-10-29-11-9-23/h12-13,15H,6-11,14H2,1-5H3,(H,21,24) |
| InChIKey | HNLSWAGZIGGLIJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |