C19H30N2O6S — CID 43007086
N-hexyl-2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 43007086) has the molecular formula C19H30N2O6S and a molecular weight of 414.52 g/mol. Its IUPAC name is N-hexyl-2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-hexyl-2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 43007086 |
| Molecular Formula | C19H30N2O6S |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-hexyl-2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCCCCCNC(=O)c1cc(S(=O)(=O)N2CCOCC2)cc(OC)c1OC |
| InChI | InChI=1S/C19H30N2O6S/c1-4-5-6-7-8-20-19(22)16-13-15(14-17(25-2)18(16)26-3)28(23,24)21-9-11-27-12-10-21/h13-14H,4-12H2,1-3H3,(H,20,22) |
| InChIKey | XTNZIGLRHHCATJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|