C27H27NO6S — CID 25398309
[(1S)-2-oxo-1,2-diphenylethyl] 3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate (PubChem CID 25398309) has the molecular formula C27H27NO6S and a molecular weight of 493.58 g/mol. Its IUPAC name is [(1S)-2-oxo-1,2-diphenylethyl] 3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate.
| Compound Name | [(1S)-2-oxo-1,2-diphenylethyl] 3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 25398309 |
| Molecular Formula | C27H27NO6S |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | [(1S)-2-oxo-1,2-diphenylethyl] 3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2cccc(C(=O)O[C@H](C(=O)c3ccccc3)c3ccccc3)c2)C[C@@H](C)O1 |
| InChI | InChI=1S/C27H27NO6S/c1-19-17-28(18-20(2)33-19)35(31,32)24-15-9-14-23(16-24)27(30)34-26(22-12-7-4-8-13-22)25(29)21-10-5-3-6-11-21/h3-16,19-20,26H,17-18H2,1-2H3/t19-,20-,26+/m1/s1 |
| InChIKey | IXGNERUDXMMDKS-KYTVRQNUSA-N |
| XLogP | 4.27 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |