C23H22N2O7S — CID 26985381
[(1R)-2-(3-morpholin-4-ylsulfonylanilino)-2-oxo-1-phenylethyl] furan-3-carboxylate (PubChem CID 26985381) has the molecular formula C23H22N2O7S and a molecular weight of 470.50 g/mol. Its IUPAC name is [(1R)-2-(3-morpholin-4-ylsulfonylanilino)-2-oxo-1-phenylethyl] furan-3-carboxylate.
| Compound Name | [(1R)-2-(3-morpholin-4-ylsulfonylanilino)-2-oxo-1-phenylethyl] furan-3-carboxylate |
|---|---|
| PubChem CID | 26985381 |
| Molecular Formula | C23H22N2O7S |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | [(1R)-2-(3-morpholin-4-ylsulfonylanilino)-2-oxo-1-phenylethyl] furan-3-carboxylate |
| SMILES | O=C(O[C@@H](C(=O)Nc1cccc(S(=O)(=O)N2CCOCC2)c1)c1ccccc1)c1ccoc1 |
| InChI | InChI=1S/C23H22N2O7S/c26-22(21(17-5-2-1-3-6-17)32-23(27)18-9-12-31-16-18)24-19-7-4-8-20(15-19)33(28,29)25-10-13-30-14-11-25/h1-9,12,15-16,21H,10-11,13-14H2,(H,24,26)/t21-/m1/s1 |
| InChIKey | SDAMUEOWSKYMGL-OAQYLSRUSA-N |
| XLogP | 2.84 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |