C24H32N4O5S — CID 30729039
(2S)-2-(2-morpholin-4-ylethylamino)-N-(3-morpholin-4-ylsulfonylphenyl)-2-phenylacetamide (PubChem CID 30729039) has the molecular formula C24H32N4O5S and a molecular weight of 488.61 g/mol. Its IUPAC name is (2S)-2-(2-morpholin-4-ylethylamino)-N-(3-morpholin-4-ylsulfonylphenyl)-2-phenylacetamide.
| Compound Name | (2S)-2-(2-morpholin-4-ylethylamino)-N-(3-morpholin-4-ylsulfonylphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 30729039 |
| Molecular Formula | C24H32N4O5S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | (2S)-2-(2-morpholin-4-ylethylamino)-N-(3-morpholin-4-ylsulfonylphenyl)-2-phenylacetamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)N2CCOCC2)c1)[C@@H](NCCN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C24H32N4O5S/c29-24(23(20-5-2-1-3-6-20)25-9-10-27-11-15-32-16-12-27)26-21-7-4-8-22(19-21)34(30,31)28-13-17-33-18-14-28/h1-8,19,23,25H,9-18H2,(H,26,29)/t23-/m0/s1 |
| InChIKey | CVWOJXSYTSMZDL-QHCPKHFHSA-N |
| XLogP | 1.31 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |