C16H24O4S — CID 101180675
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-formylcyclopenta-2,4-diene-1-sulfonate (PubChem CID 101180675) has the molecular formula C16H24O4S and a molecular weight of 312.43 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-formylcyclopenta-2,4-diene-1-sulfonate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-formylcyclopenta-2,4-diene-1-sulfonate |
|---|---|
| PubChem CID | 101180675 |
| Molecular Formula | C16H24O4S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-formylcyclopenta-2,4-diene-1-sulfonate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OS(=O)(=O)C1C=CC=C1C=O |
| InChI | InChI=1S/C16H24O4S/c1-11(2)14-8-7-12(3)9-15(14)20-21(18,19)16-6-4-5-13(16)10-17/h4-6,10-12,14-16H,7-9H2,1-3H3/t12-,14+,15-,16?/m1/s1 |
| InChIKey | ALTHQBVVWBBJEW-PKPLTAIXSA-N |
| XLogP | 2.86 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|