C20H24O6S2 — CID 23270689
[(1S,2R)-2,5,5-trideuterio-2-(4-methylphenyl)sulfonyloxycyclohexyl] 4-methylbenzenesulfonate (PubChem CID 23270689) has the molecular formula C20H24O6S2 and a molecular weight of 427.56 g/mol. Its IUPAC name is [(1S,2R)-2,5,5-trideuterio-2-(4-methylphenyl)sulfonyloxycyclohexyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2R)-2,5,5-trideuterio-2-(4-methylphenyl)sulfonyloxycyclohexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23270689 |
| Molecular Formula | C20H24O6S2 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | [(1S,2R)-2,5,5-trideuterio-2-(4-methylphenyl)sulfonyloxycyclohexyl] 4-methylbenzenesulfonate |
| SMILES | [2H]C1([2H])CC[C@@]([2H])(OS(=O)(=O)c2ccc(C)cc2)[C@@H](OS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C20H24O6S2/c1-15-7-11-17(12-8-15)27(21,22)25-19-5-3-4-6-20(19)26-28(23,24)18-13-9-16(2)10-14-18/h7-14,19-20H,3-6H2,1-2H3/t19-,20+/i3D2,20D/m0/s1 |
| InChIKey | MDNOTLODSMKMDL-KIBYUUDESA-N |
| XLogP | 3.73 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|