C18H23N5O7 — CID 131855140
4-[4-[(2,4-dinitrophenyl)hydrazinylidene]-2-hydroxy-3,3-dimethylpentyl]piperidine-2,6-dione (PubChem CID 131855140) has the molecular formula C18H23N5O7 and a molecular weight of 421.41 g/mol. Its IUPAC name is 4-[4-[(2,4-dinitrophenyl)hydrazinylidene]-2-hydroxy-3,3-dimethylpentyl]piperidine-2,6-dione.
| Compound Name | 4-[4-[(2,4-dinitrophenyl)hydrazinylidene]-2-hydroxy-3,3-dimethylpentyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 131855140 |
| Molecular Formula | C18H23N5O7 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 4-[4-[(2,4-dinitrophenyl)hydrazinylidene]-2-hydroxy-3,3-dimethylpentyl]piperidine-2,6-dione |
| SMILES | CC(=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(C)(C)C(O)CC1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C18H23N5O7/c1-10(18(2,3)15(24)6-11-7-16(25)19-17(26)8-11)20-21-13-5-4-12(22(27)28)9-14(13)23(29)30/h4-5,9,11,15,21,24H,6-8H2,1-3H3,(H,19,25,26) |
| InChIKey | FWIOSYNFJHMUIC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 177.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|