C19H19N5O10 — CID 171776113
ethyl 2-[5-[(2Z)-2-[1-(4-methoxy-3-nitrophenyl)ethylidene]hydrazinyl]-2,4-dinitrophenoxy]acetate (PubChem CID 171776113) has the molecular formula C19H19N5O10 and a molecular weight of 477.39 g/mol. Its IUPAC name is ethyl 2-[5-[(2Z)-2-[1-(4-methoxy-3-nitrophenyl)ethylidene]hydrazinyl]-2,4-dinitrophenoxy]acetate.
| Compound Name | ethyl 2-[5-[(2Z)-2-[1-(4-methoxy-3-nitrophenyl)ethylidene]hydrazinyl]-2,4-dinitrophenoxy]acetate |
|---|---|
| PubChem CID | 171776113 |
| Molecular Formula | C19H19N5O10 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | ethyl 2-[5-[(2Z)-2-[1-(4-methoxy-3-nitrophenyl)ethylidene]hydrazinyl]-2,4-dinitrophenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(N/N=C(/C)c2ccc(OC)c([N+](=O)[O-])c2)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19N5O10/c1-4-33-19(25)10-34-18-8-13(14(22(26)27)9-16(18)24(30)31)21-20-11(2)12-5-6-17(32-3)15(7-12)23(28)29/h5-9,21H,4,10H2,1-3H3/b20-11- |
| InChIKey | GMIHASXBFXCXAZ-JAIQZWGSSA-N |
| XLogP | 3.20 |
| TPSA | 198.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|