C13H20N4O4Si — CID 4556942
N-[[tert-butyl(dimethyl)silyl]methylideneamino]-2,4-dinitroaniline (PubChem CID 4556942) has the molecular formula C13H20N4O4Si and a molecular weight of 324.41 g/mol. Its IUPAC name is N-[[tert-butyl(dimethyl)silyl]methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[[tert-butyl(dimethyl)silyl]methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 4556942 |
| Molecular Formula | C13H20N4O4Si |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-[[tert-butyl(dimethyl)silyl]methylideneamino]-2,4-dinitroaniline |
| SMILES | CC(C)(C)[Si](C)(C)C=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H20N4O4Si/c1-13(2,3)22(4,5)9-14-15-11-7-6-10(16(18)19)8-12(11)17(20)21/h6-9,15H,1-5H3 |
| InChIKey | MRLFUTDGDCIQEB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|