C18H16BrN5O2 — CID 126001852
4-bromo-N-[(E)-[3,5-dimethyl-1-(3-nitrophenyl)pyrazol-4-yl]methylideneamino]aniline (PubChem CID 126001852) has the molecular formula C18H16BrN5O2 and a molecular weight of 414.26 g/mol. Its IUPAC name is 4-bromo-N-[(E)-[3,5-dimethyl-1-(3-nitrophenyl)pyrazol-4-yl]methylideneamino]aniline.
| Compound Name | 4-bromo-N-[(E)-[3,5-dimethyl-1-(3-nitrophenyl)pyrazol-4-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 126001852 |
| Molecular Formula | C18H16BrN5O2 |
| Molecular Weight | 414.26 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 4-bromo-N-[(E)-[3,5-dimethyl-1-(3-nitrophenyl)pyrazol-4-yl]methylideneamino]aniline |
| SMILES | Cc1nn(-c2cccc([N+](=O)[O-])c2)c(C)c1/C=N/Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H16BrN5O2/c1-12-18(11-20-21-15-8-6-14(19)7-9-15)13(2)23(22-12)16-4-3-5-17(10-16)24(25)26/h3-11,21H,1-2H3/b20-11+ |
| InChIKey | LIJLLXDUDWLKJK-RGVLZGJSSA-N |
| XLogP | 4.61 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.26 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|