C24H18N4O6S — CID 6186453
2-[[2-[(2E)-2-(naphthalen-2-ylmethylidene)hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid (PubChem CID 6186453) has the molecular formula C24H18N4O6S and a molecular weight of 490.50 g/mol. Its IUPAC name is 2-[[2-[(2E)-2-(naphthalen-2-ylmethylidene)hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[2-[(2E)-2-(naphthalen-2-ylmethylidene)hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 6186453 |
| Molecular Formula | C24H18N4O6S |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 2-[[2-[(2E)-2-(naphthalen-2-ylmethylidene)hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NS(=O)(=O)c1cc([N+](=O)[O-])ccc1N/N=C/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H18N4O6S/c29-24(30)20-7-3-4-8-21(20)27-35(33,34)23-14-19(28(31)32)11-12-22(23)26-25-15-16-9-10-17-5-1-2-6-18(17)13-16/h1-15,26-27H,(H,29,30)/b25-15+ |
| InChIKey | MOKKKCUMGDMIHS-MFKUBSTISA-N |
| XLogP | 4.69 |
| TPSA | 151.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_naphth_A(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|