C12H18FNO4S — CID 107866862
2-fluoro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-5-methylbenzenesulfonamide (PubChem CID 107866862) has the molecular formula C12H18FNO4S and a molecular weight of 291.34 g/mol. Its IUPAC name is 2-fluoro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-5-methylbenzenesulfonamide.
| Compound Name | 2-fluoro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 107866862 |
| Molecular Formula | C12H18FNO4S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-fluoro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-5-methylbenzenesulfonamide |
| SMILES | CCC(CO)(CO)NS(=O)(=O)c1cc(C)ccc1F |
| InChI | InChI=1S/C12H18FNO4S/c1-3-12(7-15,8-16)14-19(17,18)11-6-9(2)4-5-10(11)13/h4-6,14-16H,3,7-8H2,1-2H3 |
| InChIKey | XXJYXHHOFVGYSI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |