C12H15FN2O4S — CID 107865863
3-cyano-4-fluoro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]benzenesulfonamide (PubChem CID 107865863) has the molecular formula C12H15FN2O4S and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-cyano-4-fluoro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]benzenesulfonamide.
| Compound Name | 3-cyano-4-fluoro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 107865863 |
| Molecular Formula | C12H15FN2O4S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3-cyano-4-fluoro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]benzenesulfonamide |
| SMILES | CCC(CO)(CO)NS(=O)(=O)c1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C12H15FN2O4S/c1-2-12(7-16,8-17)15-20(18,19)10-3-4-11(13)9(5-10)6-14/h3-5,15-17H,2,7-8H2,1H3 |
| InChIKey | GRWXGACVCAMRJN-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |