C10H15FN2O5S — CID 107843632
4-amino-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-fluorobenzenesulfonamide (PubChem CID 107843632) has the molecular formula C10H15FN2O5S and a molecular weight of 294.30 g/mol. Its IUPAC name is 4-amino-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-fluorobenzenesulfonamide.
| Compound Name | 4-amino-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 107843632 |
| Molecular Formula | C10H15FN2O5S |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 4-amino-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-fluorobenzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NC(CO)(CO)CO)c(F)c1 |
| InChI | InChI=1S/C10H15FN2O5S/c11-8-3-7(12)1-2-9(8)19(17,18)13-10(4-14,5-15)6-16/h1-3,13-16H,4-6,12H2 |
| InChIKey | RYXLCCUDMSOFGY-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|