C12H19ClN2O4S — CID 107864496
5-amino-4-chloro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-methylbenzenesulfonamide (PubChem CID 107864496) has the molecular formula C12H19ClN2O4S and a molecular weight of 322.81 g/mol. Its IUPAC name is 5-amino-4-chloro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-methylbenzenesulfonamide.
| Compound Name | 5-amino-4-chloro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 107864496 |
| Molecular Formula | C12H19ClN2O4S |
| Molecular Weight | 322.81 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 5-amino-4-chloro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-methylbenzenesulfonamide |
| SMILES | CCC(CO)(CO)NS(=O)(=O)c1cc(N)c(Cl)cc1C |
| InChI | InChI=1S/C12H19ClN2O4S/c1-3-12(6-16,7-17)15-20(18,19)11-5-10(14)9(13)4-8(11)2/h4-5,15-17H,3,6-7,14H2,1-2H3 |
| InChIKey | SAGSDPVIGRYOFS-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.81 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|