C13H20BrFN2O2S — CID 106491799
2-amino-5-bromo-N-(3-ethylpentan-2-yl)-4-fluorobenzenesulfonamide (PubChem CID 106491799) has the molecular formula C13H20BrFN2O2S and a molecular weight of 367.28 g/mol. Its IUPAC name is 2-amino-5-bromo-N-(3-ethylpentan-2-yl)-4-fluorobenzenesulfonamide.
| Compound Name | 2-amino-5-bromo-N-(3-ethylpentan-2-yl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106491799 |
| Molecular Formula | C13H20BrFN2O2S |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 2-amino-5-bromo-N-(3-ethylpentan-2-yl)-4-fluorobenzenesulfonamide |
| SMILES | CCC(CC)C(C)NS(=O)(=O)c1cc(Br)c(F)cc1N |
| InChI | InChI=1S/C13H20BrFN2O2S/c1-4-9(5-2)8(3)17-20(18,19)13-6-10(14)11(15)7-12(13)16/h6-9,17H,4-5,16H2,1-3H3 |
| InChIKey | WZFPQYVOKZMDLC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|