C10H10FNO2S — CID 79014855
4-(2,3-dihydroxypropylsulfanyl)-3-fluorobenzonitrile (PubChem CID 79014855) has the molecular formula C10H10FNO2S and a molecular weight of 227.26 g/mol. Its IUPAC name is 4-(2,3-dihydroxypropylsulfanyl)-3-fluorobenzonitrile.
| Compound Name | 4-(2,3-dihydroxypropylsulfanyl)-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 79014855 |
| Molecular Formula | C10H10FNO2S |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 4-(2,3-dihydroxypropylsulfanyl)-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(SCC(O)CO)c(F)c1 |
| InChI | InChI=1S/C10H10FNO2S/c11-9-3-7(4-12)1-2-10(9)15-6-8(14)5-13/h1-3,8,13-14H,5-6H2 |
| InChIKey | VKBQVXQPYNHECD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |