C10H10FNO6S — CID 79683123
5-(2,3-dihydroxypropylsulfanyl)-4-fluoro-2-nitrobenzoic acid (PubChem CID 79683123) has the molecular formula C10H10FNO6S and a molecular weight of 291.26 g/mol. Its IUPAC name is 5-(2,3-dihydroxypropylsulfanyl)-4-fluoro-2-nitrobenzoic acid.
| Compound Name | 5-(2,3-dihydroxypropylsulfanyl)-4-fluoro-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 79683123 |
| Molecular Formula | C10H10FNO6S |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 5-(2,3-dihydroxypropylsulfanyl)-4-fluoro-2-nitrobenzoic acid |
| SMILES | O=C(O)c1cc(SCC(O)CO)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10FNO6S/c11-7-2-8(12(17)18)6(10(15)16)1-9(7)19-4-5(14)3-13/h1-2,5,13-14H,3-4H2,(H,15,16) |
| InChIKey | HUNMVXYGABVAML-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|