C12H16BrF2NO2 — CID 106263862
N-[(3-bromo-2,6-difluorophenyl)methyl]-2,3-dimethoxypropan-1-amine (PubChem CID 106263862) has the molecular formula C12H16BrF2NO2 and a molecular weight of 324.17 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)methyl]-2,3-dimethoxypropan-1-amine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-2,3-dimethoxypropan-1-amine |
|---|---|
| PubChem CID | 106263862 |
| Molecular Formula | C12H16BrF2NO2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-2,3-dimethoxypropan-1-amine |
| SMILES | COCC(CNCc1c(F)ccc(Br)c1F)OC |
| InChI | InChI=1S/C12H16BrF2NO2/c1-17-7-8(18-2)5-16-6-9-11(14)4-3-10(13)12(9)15/h3-4,8,16H,5-7H2,1-2H3 |
| InChIKey | SKQWINHNIUCHQJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|