C17H22FNOS — CID 105180648
1-(2-fluoro-3-methoxyphenyl)-N-methyl-5-thiophen-2-ylpentan-2-amine (PubChem CID 105180648) has the molecular formula C17H22FNOS and a molecular weight of 307.43 g/mol. Its IUPAC name is 1-(2-fluoro-3-methoxyphenyl)-N-methyl-5-thiophen-2-ylpentan-2-amine.
| Compound Name | 1-(2-fluoro-3-methoxyphenyl)-N-methyl-5-thiophen-2-ylpentan-2-amine |
|---|---|
| PubChem CID | 105180648 |
| Molecular Formula | C17H22FNOS |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 1-(2-fluoro-3-methoxyphenyl)-N-methyl-5-thiophen-2-ylpentan-2-amine |
| SMILES | CNC(CCCc1cccs1)Cc1cccc(OC)c1F |
| InChI | InChI=1S/C17H22FNOS/c1-19-14(7-4-8-15-9-5-11-21-15)12-13-6-3-10-16(20-2)17(13)18/h3,5-6,9-11,14,19H,4,7-8,12H2,1-2H3 |
| InChIKey | BHUBTXXLWGPYDF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |