C15H17ClFNS — CID 105178908
1-(2-chloro-3-fluorophenyl)-5-thiophen-2-ylpentan-2-amine (PubChem CID 105178908) has the molecular formula C15H17ClFNS and a molecular weight of 297.83 g/mol. Its IUPAC name is 1-(2-chloro-3-fluorophenyl)-5-thiophen-2-ylpentan-2-amine.
| Compound Name | 1-(2-chloro-3-fluorophenyl)-5-thiophen-2-ylpentan-2-amine |
|---|---|
| PubChem CID | 105178908 |
| Molecular Formula | C15H17ClFNS |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-(2-chloro-3-fluorophenyl)-5-thiophen-2-ylpentan-2-amine |
| SMILES | NC(CCCc1cccs1)Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C15H17ClFNS/c16-15-11(4-1-8-14(15)17)10-12(18)5-2-6-13-7-3-9-19-13/h1,3-4,7-9,12H,2,5-6,10,18H2 |
| InChIKey | KZIXANZIKRKFKK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |