C15H18BrNS — CID 105087550
1-(2-bromophenyl)-5-thiophen-2-ylpentan-2-amine (PubChem CID 105087550) has the molecular formula C15H18BrNS and a molecular weight of 324.29 g/mol. Its IUPAC name is 1-(2-bromophenyl)-5-thiophen-2-ylpentan-2-amine.
| Compound Name | 1-(2-bromophenyl)-5-thiophen-2-ylpentan-2-amine |
|---|---|
| PubChem CID | 105087550 |
| Molecular Formula | C15H18BrNS |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 1-(2-bromophenyl)-5-thiophen-2-ylpentan-2-amine |
| SMILES | NC(CCCc1cccs1)Cc1ccccc1Br |
| InChI | InChI=1S/C15H18BrNS/c16-15-9-2-1-5-12(15)11-13(17)6-3-7-14-8-4-10-18-14/h1-2,4-5,8-10,13H,3,6-7,11,17H2 |
| InChIKey | HDRYMULZLXSEOE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |