C15H17Cl2NS — CID 107312356
1-(2,3-dichlorophenyl)-5-thiophen-2-ylpentan-2-amine (PubChem CID 107312356) has the molecular formula C15H17Cl2NS and a molecular weight of 314.28 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-5-thiophen-2-ylpentan-2-amine.
| Compound Name | 1-(2,3-dichlorophenyl)-5-thiophen-2-ylpentan-2-amine |
|---|---|
| PubChem CID | 107312356 |
| Molecular Formula | C15H17Cl2NS |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-5-thiophen-2-ylpentan-2-amine |
| SMILES | NC(CCCc1cccs1)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H17Cl2NS/c16-14-8-1-4-11(15(14)17)10-12(18)5-2-6-13-7-3-9-19-13/h1,3-4,7-9,12H,2,5-6,10,18H2 |
| InChIKey | LDWRRAQEFRDERD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |