About 2-[(3,4-dichlorophenyl)methylsulfanylmethyl]thiophene
2-[(3,4-dichlorophenyl)methylsulfanylmethyl]thiophene (PubChem CID 5060586) has the molecular formula C12H10Cl2S2
and a molecular weight of 289.25 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylsulfanylmethyl]thiophene.
Analyze 2-[(3,4-dichlorophenyl)methylsulfanylmethyl]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4-dichlorophenyl)methylsulfanylmethyl]thiophene?
The IUPAC name of 2-[(3,4-dichlorophenyl)methylsulfanylmethyl]thiophene (CID 5060586) is 2-[(3,4-dichlorophenyl)methylsulfanylmethyl]thiophene.
What is the SMILES notation for 2-[(3,4-dichlorophenyl)methylsulfanylmethyl]thiophene?
The canonical SMILES for 2-[(3,4-dichlorophenyl)methylsulfanylmethyl]thiophene is Clc1ccc(CSCc2cccs2)cc1Cl.
What is the InChIKey of 2-[(3,4-dichlorophenyl)methylsulfanylmethyl]thiophene?
The InChIKey is BYGMJPWUSZPWJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2S2/c13-11-4-3-9(6-12(11)14)7-15-8-10-2-1-5-16-10/h1-6H,7-8H2.
What are the key properties of 2-[(3,4-dichlorophenyl)methylsulfanylmethyl]thiophene?
2-[(3,4-dichlorophenyl)methylsulfanylmethyl]thiophene has a molecular weight of 289.25 g/mol, XLogP of 5.49, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dichlorophenyl)methylsulfanylmethyl]thiophene is sourced from PubChem (CID 5060586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).