C10H9Cl2NS — CID 82181449
3-[(3,4-dichlorophenyl)methylsulfanyl]propanenitrile (PubChem CID 82181449) has the molecular formula C10H9Cl2NS and a molecular weight of 246.16 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methylsulfanyl]propanenitrile.
| Compound Name | 3-[(3,4-dichlorophenyl)methylsulfanyl]propanenitrile |
|---|---|
| PubChem CID | 82181449 |
| Molecular Formula | C10H9Cl2NS |
| Molecular Weight | 246.16 g/mol |
| Exact Mass | 244.98 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methylsulfanyl]propanenitrile |
| SMILES | N#CCCSCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2NS/c11-9-3-2-8(6-10(9)12)7-14-5-1-4-13/h2-3,6H,1,5,7H2 |
| InChIKey | OLAWCNLQLFYPJU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.16 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|