C11H15Cl2NOS — CID 82181088
2-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethoxy]ethanamine (PubChem CID 82181088) has the molecular formula C11H15Cl2NOS and a molecular weight of 280.22 g/mol. Its IUPAC name is 2-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethoxy]ethanamine.
| Compound Name | 2-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethoxy]ethanamine |
|---|---|
| PubChem CID | 82181088 |
| Molecular Formula | C11H15Cl2NOS |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 2-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethoxy]ethanamine |
| SMILES | NCCOCCSCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H15Cl2NOS/c12-10-2-1-9(7-11(10)13)8-16-6-5-15-4-3-14/h1-2,7H,3-6,8,14H2 |
| InChIKey | GCUUBCMHUWDIHJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|