C12H10Cl3NO2 — CID 160533977
(3,4-dichlorophenyl)methanamine;furan-2-carbonyl chloride (PubChem CID 160533977) has the molecular formula C12H10Cl3NO2 and a molecular weight of 306.58 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methanamine;furan-2-carbonyl chloride.
| Compound Name | (3,4-dichlorophenyl)methanamine;furan-2-carbonyl chloride |
|---|---|
| PubChem CID | 160533977 |
| Molecular Formula | C12H10Cl3NO2 |
| Molecular Weight | 306.58 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | (3,4-dichlorophenyl)methanamine;furan-2-carbonyl chloride |
| SMILES | NCc1ccc(Cl)c(Cl)c1.O=C(Cl)c1ccco1 |
| InChI | InChI=1S/C7H7Cl2N.C5H3ClO2/c8-6-2-1-5(4-10)3-7(6)9;6-5(7)4-2-1-3-8-4/h1-3H,4,10H2;1-3H |
| InChIKey | QVXKDURNFVTBQZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|